About Triisobutylsilane
Triisobutylsilane (PubChem CID 11019901) has the molecular formula C12H27Si
and a molecular weight of 199.43 g/mol.
Molecular Properties
| Compound Name | Triisobutylsilane |
| PubChem CID | 11019901 |
| Molecular Formula | C12H27Si |
| Molecular Weight | 199.43 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | — |
| SMILES | CC(C)C[Si](CC(C)C)CC(C)C |
| InChI | InChI=1S/C12H27Si/c1-10(2)7-13(8-11(3)4)9-12(5)6/h10-12H,7-9H2,1-6H3 |
| InChIKey | GEUFMGZEFYJAEJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Triisobutylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Triisobutylsilane?
The IUPAC name of Triisobutylsilane (CID 11019901) is not available.
What is the SMILES notation for Triisobutylsilane?
The canonical SMILES for Triisobutylsilane is CC(C)C[Si](CC(C)C)CC(C)C.
What is the InChIKey of Triisobutylsilane?
The InChIKey is GEUFMGZEFYJAEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27Si/c1-10(2)7-13(8-11(3)4)9-12(5)6/h10-12H,7-9H2,1-6H3.
What are the key properties of Triisobutylsilane?
Triisobutylsilane has a molecular weight of 199.43 g/mol, XLogP of 4.45, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Triisobutylsilane is sourced from PubChem (CID 11019901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).