C20H28N2O2 — CID 110199286
(1R,11S)-2-(2-phenylacetyl)-2,9-diazabicyclo[9.3.0]tetradecan-10-one (PubChem CID 110199286) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (1R,11S)-2-(2-phenylacetyl)-2,9-diazabicyclo[9.3.0]tetradecan-10-one.
| Compound Name | (1R,11S)-2-(2-phenylacetyl)-2,9-diazabicyclo[9.3.0]tetradecan-10-one |
|---|---|
| PubChem CID | 110199286 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (1R,11S)-2-(2-phenylacetyl)-2,9-diazabicyclo[9.3.0]tetradecan-10-one |
| SMILES | O=C1NCCCCCCN(C(=O)Cc2ccccc2)[C@@H]2CCC[C@H]12 |
| InChI | InChI=1S/C20H28N2O2/c23-19(15-16-9-4-3-5-10-16)22-14-7-2-1-6-13-21-20(24)17-11-8-12-18(17)22/h3-5,9-10,17-18H,1-2,6-8,11-15H2,(H,21,24)/t17-,18+/m0/s1 |
| InChIKey | KLRBVPUHDIJRNF-ZWKOTPCHSA-N |
| XLogP | 2.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |