C21H29N3O — CID 110199306
(1S,11R)-2-(1H-indol-4-ylmethyl)-2,9-diazabicyclo[9.3.0]tetradecan-10-one (PubChem CID 110199306) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is (1S,11R)-2-(1H-indol-4-ylmethyl)-2,9-diazabicyclo[9.3.0]tetradecan-10-one.
| Compound Name | (1S,11R)-2-(1H-indol-4-ylmethyl)-2,9-diazabicyclo[9.3.0]tetradecan-10-one |
|---|---|
| PubChem CID | 110199306 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | (1S,11R)-2-(1H-indol-4-ylmethyl)-2,9-diazabicyclo[9.3.0]tetradecan-10-one |
| SMILES | O=C1NCCCCCCN(Cc2cccc3[nH]ccc23)[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C21H29N3O/c25-21-18-8-6-10-20(18)24(14-4-2-1-3-12-23-21)15-16-7-5-9-19-17(16)11-13-22-19/h5,7,9,11,13,18,20,22H,1-4,6,8,10,12,14-15H2,(H,23,25)/t18-,20+/m1/s1 |
| InChIKey | GQBZEKGNTOUPEQ-QUCCMNQESA-N |
| XLogP | 3.83 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |