C22H26N4OS — CID 110200155
4-phenyl-5-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-1,5-diazecan-2-one (PubChem CID 110200155) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is 4-phenyl-5-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-1,5-diazecan-2-one.
| Compound Name | 4-phenyl-5-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-1,5-diazecan-2-one |
|---|---|
| PubChem CID | 110200155 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 4-phenyl-5-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-1,5-diazecan-2-one |
| SMILES | O=C1CC(c2ccccc2)N(Cc2cn[nH]c2-c2cccs2)CCCCCN1 |
| InChI | InChI=1S/C22H26N4OS/c27-21-14-19(17-8-3-1-4-9-17)26(12-6-2-5-11-23-21)16-18-15-24-25-22(18)20-10-7-13-28-20/h1,3-4,7-10,13,15,19H,2,5-6,11-12,14,16H2,(H,23,27)(H,24,25) |
| InChIKey | IPMNBIDPLRZHFE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |