C25H32N4O4 — CID 110200275
1-(2-ethoxyphenyl)-3-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]urea (PubChem CID 110200275) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]urea.
| Compound Name | 1-(2-ethoxyphenyl)-3-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 110200275 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]urea |
| SMILES | CCOc1ccccc1NC(=O)NCC(=O)N1CCCCCNC(=O)CC1c1ccccc1 |
| InChI | InChI=1S/C25H32N4O4/c1-2-33-22-14-8-7-13-20(22)28-25(32)27-18-24(31)29-16-10-4-9-15-26-23(30)17-21(29)19-11-5-3-6-12-19/h3,5-8,11-14,21H,2,4,9-10,15-18H2,1H3,(H,26,30)(H2,27,28,32) |
| InChIKey | MZVDIJNSMJZGCQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |