C21H29N5O4S — CID 110200304
1-ethyl-N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]pyrazole-4-sulfonamide (PubChem CID 110200304) has the molecular formula C21H29N5O4S and a molecular weight of 447.56 g/mol. Its IUPAC name is 1-ethyl-N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]pyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 110200304 |
| Molecular Formula | C21H29N5O4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 1-ethyl-N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCC(=O)N2CCCCCNC(=O)CC2c2ccccc2)cn1 |
| InChI | InChI=1S/C21H29N5O4S/c1-2-25-16-18(14-23-25)31(29,30)24-15-21(28)26-12-8-4-7-11-22-20(27)13-19(26)17-9-5-3-6-10-17/h3,5-6,9-10,14,16,19,24H,2,4,7-8,11-13,15H2,1H3,(H,22,27) |
| InChIKey | OBPJSDLAGDWQKL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |