C13H24N2O4S — CID 110201033
(8aS,12aR)-1-ethylsulfonyl-3,5,6,7,8a,9,10,11,12,12a-decahydro-2H-benzo[e][1,4,8]oxadiazecin-8-one (PubChem CID 110201033) has the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. Its IUPAC name is (8aS,12aR)-1-ethylsulfonyl-3,5,6,7,8a,9,10,11,12,12a-decahydro-2H-benzo[e][1,4,8]oxadiazecin-8-one.
| Compound Name | (8aS,12aR)-1-ethylsulfonyl-3,5,6,7,8a,9,10,11,12,12a-decahydro-2H-benzo[e][1,4,8]oxadiazecin-8-one |
|---|---|
| PubChem CID | 110201033 |
| Molecular Formula | C13H24N2O4S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (8aS,12aR)-1-ethylsulfonyl-3,5,6,7,8a,9,10,11,12,12a-decahydro-2H-benzo[e][1,4,8]oxadiazecin-8-one |
| SMILES | CCS(=O)(=O)N1CCOCCNC(=O)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C13H24N2O4S/c1-2-20(17,18)15-8-10-19-9-7-14-13(16)11-5-3-4-6-12(11)15/h11-12H,2-10H2,1H3,(H,14,16)/t11-,12+/m0/s1 |
| InChIKey | VNXGDOSTEKFQAI-NWDGAFQWSA-N |
| XLogP | 0.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |