C25H33N3O2 — CID 110201056
(4-benzylpiperazin-1-yl)-(7-hydroxy-1-methyl-2,3,4,5,6,7-hexahydro-1-benzazonin-9-yl)methanone (PubChem CID 110201056) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-(7-hydroxy-1-methyl-2,3,4,5,6,7-hexahydro-1-benzazonin-9-yl)methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-(7-hydroxy-1-methyl-2,3,4,5,6,7-hexahydro-1-benzazonin-9-yl)methanone |
|---|---|
| PubChem CID | 110201056 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-(7-hydroxy-1-methyl-2,3,4,5,6,7-hexahydro-1-benzazonin-9-yl)methanone |
| SMILES | CN1CCCCCC(O)c2cc(C(=O)N3CCN(Cc4ccccc4)CC3)ccc21 |
| InChI | InChI=1S/C25H33N3O2/c1-26-13-7-3-6-10-24(29)22-18-21(11-12-23(22)26)25(30)28-16-14-27(15-17-28)19-20-8-4-2-5-9-20/h2,4-5,8-9,11-12,18,24,29H,3,6-7,10,13-17,19H2,1H3 |
| InChIKey | DQDXZLKMLCYMOH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |