C22H25F3N2O2 — CID 110201067
7-hydroxy-1-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide (PubChem CID 110201067) has the molecular formula C22H25F3N2O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is 7-hydroxy-1-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide.
| Compound Name | 7-hydroxy-1-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide |
|---|---|
| PubChem CID | 110201067 |
| Molecular Formula | C22H25F3N2O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 7-hydroxy-1-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide |
| SMILES | CN1CCCCCC(O)c2cc(C(=O)NCc3cccc(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C22H25F3N2O2/c1-27-11-4-2-3-8-20(28)18-13-16(9-10-19(18)27)21(29)26-14-15-6-5-7-17(12-15)22(23,24)25/h5-7,9-10,12-13,20,28H,2-4,8,11,14H2,1H3,(H,26,29) |
| InChIKey | RUPCHXVBZVGECQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |