About (1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one
(1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one (PubChem CID 110201224) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is (1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one.
Molecular Properties
| Compound Name | (1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one |
| PubChem CID | 110201224 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one |
| SMILES | O=C1NCCCCCCN[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C13H24N2O/c16-13-11-7-3-4-8-12(11)14-9-5-1-2-6-10-15-13/h11-12,14H,1-10H2,(H,15,16)/t11-,12+/m1/s1 |
| InChIKey | LOGUPMNNNMYXAE-NEPJUHHUSA-N |
| XLogP | 1.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one?
The IUPAC name of (1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one (CID 110201224) is (1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one.
What is the SMILES notation for (1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one?
The canonical SMILES for (1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one is O=C1NCCCCCCN[C@H]2CCCC[C@@H]12.
What is the InChIKey of (1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one?
The InChIKey is LOGUPMNNNMYXAE-NEPJUHHUSA-N. The full InChI is InChI=1S/C13H24N2O/c16-13-11-7-3-4-8-12(11)14-9-5-1-2-6-10-15-13/h11-12,14H,1-10H2,(H,15,16)/t11-,12+/m1/s1.
What are the key properties of (1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one?
(1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one has a molecular weight of 224.35 g/mol, XLogP of 1.83, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,11R)-2,9-diazabicyclo[9.4.0]pentadecan-10-one is sourced from PubChem (CID 110201224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).