C15H26N2O3 — CID 110201276
(8aR,12aS)-1-(2-methoxyacetyl)-2,3,4,5,6,7,8a,9,10,11,12,12a-dodecahydrobenzo[b][1,5]diazecin-8-one (PubChem CID 110201276) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is (8aR,12aS)-1-(2-methoxyacetyl)-2,3,4,5,6,7,8a,9,10,11,12,12a-dodecahydrobenzo[b][1,5]diazecin-8-one.
| Compound Name | (8aR,12aS)-1-(2-methoxyacetyl)-2,3,4,5,6,7,8a,9,10,11,12,12a-dodecahydrobenzo[b][1,5]diazecin-8-one |
|---|---|
| PubChem CID | 110201276 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | (8aR,12aS)-1-(2-methoxyacetyl)-2,3,4,5,6,7,8a,9,10,11,12,12a-dodecahydrobenzo[b][1,5]diazecin-8-one |
| SMILES | COCC(=O)N1CCCCCNC(=O)[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C15H26N2O3/c1-20-11-14(18)17-10-6-2-5-9-16-15(19)12-7-3-4-8-13(12)17/h12-13H,2-11H2,1H3,(H,16,19)/t12-,13+/m1/s1 |
| InChIKey | MWCORBZGIRDEPE-OLZOCXBDSA-N |
| XLogP | 1.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |