C21H31N3O2 — CID 110201310
(8aR,12aS)-N-[(4-methylphenyl)methyl]-8-oxo-2,3,4,5,6,7,8a,9,10,11,12,12a-dodecahydrobenzo[b][1,5]diazecine-1-carboxamide (PubChem CID 110201310) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is (8aR,12aS)-N-[(4-methylphenyl)methyl]-8-oxo-2,3,4,5,6,7,8a,9,10,11,12,12a-dodecahydrobenzo[b][1,5]diazecine-1-carboxamide.
| Compound Name | (8aR,12aS)-N-[(4-methylphenyl)methyl]-8-oxo-2,3,4,5,6,7,8a,9,10,11,12,12a-dodecahydrobenzo[b][1,5]diazecine-1-carboxamide |
|---|---|
| PubChem CID | 110201310 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | (8aR,12aS)-N-[(4-methylphenyl)methyl]-8-oxo-2,3,4,5,6,7,8a,9,10,11,12,12a-dodecahydrobenzo[b][1,5]diazecine-1-carboxamide |
| SMILES | Cc1ccc(CNC(=O)N2CCCCCNC(=O)[C@@H]3CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C21H31N3O2/c1-16-9-11-17(12-10-16)15-23-21(26)24-14-6-2-5-13-22-20(25)18-7-3-4-8-19(18)24/h9-12,18-19H,2-8,13-15H2,1H3,(H,22,25)(H,23,26)/t18-,19+/m1/s1 |
| InChIKey | RLSKWJYRTSYBNK-MOPGFXCFSA-N |
| XLogP | 3.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |