About 5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one
5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one (PubChem CID 110201347) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is 5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one.
Molecular Properties
| Compound Name | 5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one |
| PubChem CID | 110201347 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one |
| SMILES | O=C1CCN(C(=O)c2ccoc2)CCCCCCN1 |
| InChI | InChI=1S/C14H20N2O3/c17-13-5-9-16(8-4-2-1-3-7-15-13)14(18)12-6-10-19-11-12/h6,10-11H,1-5,7-9H2,(H,15,17) |
| InChIKey | QZMANZKUOSPELP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one?
The IUPAC name of 5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one (CID 110201347) is 5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one.
What is the SMILES notation for 5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one?
The canonical SMILES for 5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one is O=C1CCN(C(=O)c2ccoc2)CCCCCCN1.
What is the InChIKey of 5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one?
The InChIKey is QZMANZKUOSPELP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c17-13-5-9-16(8-4-2-1-3-7-15-13)14(18)12-6-10-19-11-12/h6,10-11H,1-5,7-9H2,(H,15,17).
What are the key properties of 5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one?
5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one has a molecular weight of 264.32 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-3-carbonyl)-1,5-diazacycloundecan-2-one is sourced from PubChem (CID 110201347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).