C16H23N3O3 — CID 110201554
(8aR,11aS)-1-(4-methyl-1,3-oxazole-5-carbonyl)-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one (PubChem CID 110201554) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (8aR,11aS)-1-(4-methyl-1,3-oxazole-5-carbonyl)-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one.
| Compound Name | (8aR,11aS)-1-(4-methyl-1,3-oxazole-5-carbonyl)-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one |
|---|---|
| PubChem CID | 110201554 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (8aR,11aS)-1-(4-methyl-1,3-oxazole-5-carbonyl)-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one |
| SMILES | Cc1ncoc1C(=O)N1CCCCCNC(=O)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C16H23N3O3/c1-11-14(22-10-18-11)16(21)19-9-4-2-3-8-17-15(20)12-6-5-7-13(12)19/h10,12-13H,2-9H2,1H3,(H,17,20)/t12-,13+/m1/s1 |
| InChIKey | WSJXFQHCZKXEBH-OLZOCXBDSA-N |
| XLogP | 1.89 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |