C11H20N2O — CID 110201558
(8aR,11aS)-1,2,3,4,5,6,7,8a,9,10,11,11a-dodecahydrocyclopenta[b][1,5]diazecin-8-one (PubChem CID 110201558) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is (8aR,11aS)-1,2,3,4,5,6,7,8a,9,10,11,11a-dodecahydrocyclopenta[b][1,5]diazecin-8-one.
| Compound Name | (8aR,11aS)-1,2,3,4,5,6,7,8a,9,10,11,11a-dodecahydrocyclopenta[b][1,5]diazecin-8-one |
|---|---|
| PubChem CID | 110201558 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (8aR,11aS)-1,2,3,4,5,6,7,8a,9,10,11,11a-dodecahydrocyclopenta[b][1,5]diazecin-8-one |
| SMILES | O=C1NCCCCCN[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C11H20N2O/c14-11-9-5-4-6-10(9)12-7-2-1-3-8-13-11/h9-10,12H,1-8H2,(H,13,14)/t9-,10+/m1/s1 |
| InChIKey | GKQRVYMFPYYGOO-ZJUUUORDSA-N |
| XLogP | 1.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |