C19H33N3O2 — CID 110201573
(8aR,11aS)-1-[2-(azepan-1-yl)acetyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one (PubChem CID 110201573) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is (8aR,11aS)-1-[2-(azepan-1-yl)acetyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one.
| Compound Name | (8aR,11aS)-1-[2-(azepan-1-yl)acetyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one |
|---|---|
| PubChem CID | 110201573 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | (8aR,11aS)-1-[2-(azepan-1-yl)acetyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one |
| SMILES | O=C1NCCCCCN(C(=O)CN2CCCCCC2)[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C19H33N3O2/c23-18(15-21-12-5-1-2-6-13-21)22-14-7-3-4-11-20-19(24)16-9-8-10-17(16)22/h16-17H,1-15H2,(H,20,24)/t16-,17+/m1/s1 |
| InChIKey | CYVBOQRAMRGFKC-SJORKVTESA-N |
| XLogP | 2.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |