C21H28N4O — CID 110201596
(8aR,11aS)-1-[(5-phenyl-1H-pyrazol-4-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one (PubChem CID 110201596) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is (8aR,11aS)-1-[(5-phenyl-1H-pyrazol-4-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one.
| Compound Name | (8aR,11aS)-1-[(5-phenyl-1H-pyrazol-4-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one |
|---|---|
| PubChem CID | 110201596 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | (8aR,11aS)-1-[(5-phenyl-1H-pyrazol-4-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one |
| SMILES | O=C1NCCCCCN(Cc2cn[nH]c2-c2ccccc2)[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C21H28N4O/c26-21-18-10-7-11-19(18)25(13-6-2-5-12-22-21)15-17-14-23-24-20(17)16-8-3-1-4-9-16/h1,3-4,8-9,14,18-19H,2,5-7,10-13,15H2,(H,22,26)(H,23,24)/t18-,19+/m1/s1 |
| InChIKey | HJTCXQZPZJCYRQ-MOPGFXCFSA-N |
| XLogP | 3.35 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |