C21H29N3O — CID 110201598
(8aR,11aS)-1-[(1-methylindol-3-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one (PubChem CID 110201598) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is (8aR,11aS)-1-[(1-methylindol-3-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one.
| Compound Name | (8aR,11aS)-1-[(1-methylindol-3-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one |
|---|---|
| PubChem CID | 110201598 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | (8aR,11aS)-1-[(1-methylindol-3-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one |
| SMILES | Cn1cc(CN2CCCCCNC(=O)[C@@H]3CCC[C@@H]32)c2ccccc21 |
| InChI | InChI=1S/C21H29N3O/c1-23-14-16(17-8-3-4-10-19(17)23)15-24-13-6-2-5-12-22-21(25)18-9-7-11-20(18)24/h3-4,8,10,14,18,20H,2,5-7,9,11-13,15H2,1H3,(H,22,25)/t18-,20+/m1/s1 |
| InChIKey | JFCIRPHVNZZCSB-QUCCMNQESA-N |
| XLogP | 3.45 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |