C18H30N4O — CID 110201604
(8aR,11aS)-1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one (PubChem CID 110201604) has the molecular formula C18H30N4O and a molecular weight of 318.46 g/mol. Its IUPAC name is (8aR,11aS)-1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one.
| Compound Name | (8aR,11aS)-1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one |
|---|---|
| PubChem CID | 110201604 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | (8aR,11aS)-1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one |
| SMILES | CCn1cc(CN2CCCCCNC(=O)[C@@H]3CCC[C@@H]32)c(C)n1 |
| InChI | InChI=1S/C18H30N4O/c1-3-22-13-15(14(2)20-22)12-21-11-6-4-5-10-19-18(23)16-8-7-9-17(16)21/h13,16-17H,3-12H2,1-2H3,(H,19,23)/t16-,17+/m1/s1 |
| InChIKey | DYPNRTLQPFUHRP-SJORKVTESA-N |
| XLogP | 2.48 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |