C16H21FN2O3 — CID 110201618
8-[2-(3-fluorophenyl)acetyl]-1-oxa-4,8-diazacycloundecan-5-one (PubChem CID 110201618) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is 8-[2-(3-fluorophenyl)acetyl]-1-oxa-4,8-diazacycloundecan-5-one.
| Compound Name | 8-[2-(3-fluorophenyl)acetyl]-1-oxa-4,8-diazacycloundecan-5-one |
|---|---|
| PubChem CID | 110201618 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 8-[2-(3-fluorophenyl)acetyl]-1-oxa-4,8-diazacycloundecan-5-one |
| SMILES | O=C1CCN(C(=O)Cc2cccc(F)c2)CCCOCCN1 |
| InChI | InChI=1S/C16H21FN2O3/c17-14-4-1-3-13(11-14)12-16(21)19-7-2-9-22-10-6-18-15(20)5-8-19/h1,3-4,11H,2,5-10,12H2,(H,18,20) |
| InChIKey | PWSIWSGZQRGFFW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |