C23H33N5O4S — CID 110202064
(1S,11S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(pyridin-4-ylmethyl)-2,9,14-triazabicyclo[9.4.0]pentadecan-10-one (PubChem CID 110202064) has the molecular formula C23H33N5O4S and a molecular weight of 475.62 g/mol. Its IUPAC name is (1S,11S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(pyridin-4-ylmethyl)-2,9,14-triazabicyclo[9.4.0]pentadecan-10-one.
| Compound Name | (1S,11S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(pyridin-4-ylmethyl)-2,9,14-triazabicyclo[9.4.0]pentadecan-10-one |
|---|---|
| PubChem CID | 110202064 |
| Molecular Formula | C23H33N5O4S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | (1S,11S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(pyridin-4-ylmethyl)-2,9,14-triazabicyclo[9.4.0]pentadecan-10-one |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CC[C@@H]2C(=O)NCCCCCCN(Cc3ccncc3)[C@@H]2C1 |
| InChI | InChI=1S/C23H33N5O4S/c1-17-22(18(2)32-26-17)33(30,31)28-14-9-20-21(16-28)27(15-19-7-11-24-12-8-19)13-6-4-3-5-10-25-23(20)29/h7-8,11-12,20-21H,3-6,9-10,13-16H2,1-2H3,(H,25,29)/t20-,21+/m0/s1 |
| InChIKey | SWMUONHNCDZUTA-LEWJYISDSA-N |
| XLogP | 2.26 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |