C13H24O2 — CID 11020214
(4S,5S)-4-ethenyl-5-hexyl-2,2-dimethyl-1,3-dioxolane (PubChem CID 11020214) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (4S,5S)-4-ethenyl-5-hexyl-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5S)-4-ethenyl-5-hexyl-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11020214 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (4S,5S)-4-ethenyl-5-hexyl-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@H]1CCCCCC |
| InChI | InChI=1S/C13H24O2/c1-5-7-8-9-10-12-11(6-2)14-13(3,4)15-12/h6,11-12H,2,5,7-10H2,1,3-4H3/t11-,12-/m0/s1 |
| InChIKey | UNNWCYKQFWLEPA-RYUDHWBXSA-N |
| XLogP | 3.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|