C22H26F2N2O — CID 110202207
5-[(2,4-difluorophenyl)methyl]-4-phenyl-1,5-diazacycloundecan-2-one (PubChem CID 110202207) has the molecular formula C22H26F2N2O and a molecular weight of 372.46 g/mol. Its IUPAC name is 5-[(2,4-difluorophenyl)methyl]-4-phenyl-1,5-diazacycloundecan-2-one.
| Compound Name | 5-[(2,4-difluorophenyl)methyl]-4-phenyl-1,5-diazacycloundecan-2-one |
|---|---|
| PubChem CID | 110202207 |
| Molecular Formula | C22H26F2N2O |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 5-[(2,4-difluorophenyl)methyl]-4-phenyl-1,5-diazacycloundecan-2-one |
| SMILES | O=C1CC(c2ccccc2)N(Cc2ccc(F)cc2F)CCCCCCN1 |
| InChI | InChI=1S/C22H26F2N2O/c23-19-11-10-18(20(24)14-19)16-26-13-7-2-1-6-12-25-22(27)15-21(26)17-8-4-3-5-9-17/h3-5,8-11,14,21H,1-2,6-7,12-13,15-16H2,(H,25,27) |
| InChIKey | QNHYQJUSNSEANV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |