About [(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol
[(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol (PubChem CID 110202661) has the molecular formula C18H19F3N2O2
and a molecular weight of 352.36 g/mol. Its IUPAC name is [(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol |
| PubChem CID | 110202661 |
| Molecular Formula | C18H19F3N2O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol |
| SMILES | OC[C@@H]1CN(Cc2ccccc2OC(F)(F)F)C[C@H]1c1ccncc1 |
| InChI | InChI=1S/C18H19F3N2O2/c19-18(20,21)25-17-4-2-1-3-14(17)9-23-10-15(12-24)16(11-23)13-5-7-22-8-6-13/h1-8,15-16,24H,9-12H2/t15-,16-/m0/s1 |
| InChIKey | PPIYZBCNNONOCY-HOTGVXAUSA-N |
| XLogP | 3.19 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol?
The IUPAC name of [(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol (CID 110202661) is [(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol?
The canonical SMILES for [(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol is OC[C@@H]1CN(Cc2ccccc2OC(F)(F)F)C[C@H]1c1ccncc1.
What is the InChIKey of [(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol?
The InChIKey is PPIYZBCNNONOCY-HOTGVXAUSA-N. The full InChI is InChI=1S/C18H19F3N2O2/c19-18(20,21)25-17-4-2-1-3-14(17)9-23-10-15(12-24)16(11-23)13-5-7-22-8-6-13/h1-8,15-16,24H,9-12H2/t15-,16-/m0/s1.
What are the key properties of [(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol?
[(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol has a molecular weight of 352.36 g/mol, XLogP of 3.19, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-pyridin-4-yl-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]methanol is sourced from PubChem (CID 110202661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).