About [(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol
[(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol (PubChem CID 110202709) has the molecular formula C16H22N4O
and a molecular weight of 286.38 g/mol. Its IUPAC name is [(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol |
| PubChem CID | 110202709 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol |
| SMILES | Cc1nn(C)cc1CN1C[C@@H](CO)[C@H](c2ccncc2)C1 |
| InChI | InChI=1S/C16H22N4O/c1-12-14(7-19(2)18-12)8-20-9-15(11-21)16(10-20)13-3-5-17-6-4-13/h3-7,15-16,21H,8-11H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | ZVCQTAFWWRZUAV-HOTGVXAUSA-N |
| XLogP | 1.33 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol?
The IUPAC name of [(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol (CID 110202709) is [(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol?
The canonical SMILES for [(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol is Cc1nn(C)cc1CN1C[C@@H](CO)[C@H](c2ccncc2)C1.
What is the InChIKey of [(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol?
The InChIKey is ZVCQTAFWWRZUAV-HOTGVXAUSA-N. The full InChI is InChI=1S/C16H22N4O/c1-12-14(7-19(2)18-12)8-20-9-15(11-21)16(10-20)13-3-5-17-6-4-13/h3-7,15-16,21H,8-11H2,1-2H3/t15-,16-/m0/s1.
What are the key properties of [(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol?
[(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol has a molecular weight of 286.38 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-4-pyridin-4-ylpyrrolidin-3-yl]methanol is sourced from PubChem (CID 110202709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).