About 1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone
1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone (PubChem CID 110203312) has the molecular formula C18H20N2O3
and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone.
Molecular Properties
| Compound Name | 1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone |
| PubChem CID | 110203312 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1C[C@@H](CO)[C@H](c2ccccn2)C1 |
| InChI | InChI=1S/C18H20N2O3/c21-12-14-10-20(11-16(14)17-8-4-5-9-19-17)18(22)13-23-15-6-2-1-3-7-15/h1-9,14,16,21H,10-13H2/t14-,16+/m0/s1 |
| InChIKey | YTQPMVTUHFHZLK-GOEBONIOSA-N |
| XLogP | 1.69 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone?
The IUPAC name of 1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone (CID 110203312) is 1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone.
What is the SMILES notation for 1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone?
The canonical SMILES for 1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone is O=C(COc1ccccc1)N1C[C@@H](CO)[C@H](c2ccccn2)C1.
What is the InChIKey of 1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone?
The InChIKey is YTQPMVTUHFHZLK-GOEBONIOSA-N. The full InChI is InChI=1S/C18H20N2O3/c21-12-14-10-20(11-16(14)17-8-4-5-9-19-17)18(22)13-23-15-6-2-1-3-7-15/h1-9,14,16,21H,10-13H2/t14-,16+/m0/s1.
What are the key properties of 1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone?
1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone has a molecular weight of 312.37 g/mol, XLogP of 1.69, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,4S)-3-(hydroxymethyl)-4-pyridin-2-ylpyrrolidin-1-yl]-2-phenoxyethanone is sourced from PubChem (CID 110203312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).