About 2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane
2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane (PubChem CID 11020362) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane.
Molecular Properties
| Compound Name | 2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane |
| PubChem CID | 11020362 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane |
| SMILES | CC#C/C=C(/C)C#CCOC1CCCCO1 |
| InChI | InChI=1S/C14H18O2/c1-3-4-8-13(2)9-7-12-16-14-10-5-6-11-15-14/h8,14H,5-6,10-12H2,1-2H3/b13-8- |
| InChIKey | UWILOHRSQPPMKM-JYRVWZFOSA-N |
| XLogP | 2.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane?
The IUPAC name of 2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane (CID 11020362) is 2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane.
What is the SMILES notation for 2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane?
The canonical SMILES for 2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane is CC#C/C=C(/C)C#CCOC1CCCCO1.
What is the InChIKey of 2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane?
The InChIKey is UWILOHRSQPPMKM-JYRVWZFOSA-N. The full InChI is InChI=1S/C14H18O2/c1-3-4-8-13(2)9-7-12-16-14-10-5-6-11-15-14/h8,14H,5-6,10-12H2,1-2H3/b13-8-.
What are the key properties of 2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane?
2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane has a molecular weight of 218.30 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-4-methyloct-4-en-2,6-diynoxy]oxane is sourced from PubChem (CID 11020362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).