About 3-chloro-6-phenylbenzene-1,2-diol
3-chloro-6-phenylbenzene-1,2-diol (PubChem CID 11020432) has the molecular formula C12H9ClO2
and a molecular weight of 220.66 g/mol. Its IUPAC name is 3-chloro-6-phenylbenzene-1,2-diol.
Molecular Properties
| Compound Name | 3-chloro-6-phenylbenzene-1,2-diol |
| PubChem CID | 11020432 |
| Molecular Formula | C12H9ClO2 |
| Molecular Weight | 220.66 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 3-chloro-6-phenylbenzene-1,2-diol |
| SMILES | Oc1c(Cl)ccc(-c2ccccc2)c1O |
| InChI | InChI=1S/C12H9ClO2/c13-10-7-6-9(11(14)12(10)15)8-4-2-1-3-5-8/h1-7,14-15H |
| InChIKey | SBZPASPFBUIKKP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.66 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-6-phenylbenzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-phenylbenzene-1,2-diol?
The IUPAC name of 3-chloro-6-phenylbenzene-1,2-diol (CID 11020432) is 3-chloro-6-phenylbenzene-1,2-diol.
What is the SMILES notation for 3-chloro-6-phenylbenzene-1,2-diol?
The canonical SMILES for 3-chloro-6-phenylbenzene-1,2-diol is Oc1c(Cl)ccc(-c2ccccc2)c1O.
What is the InChIKey of 3-chloro-6-phenylbenzene-1,2-diol?
The InChIKey is SBZPASPFBUIKKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClO2/c13-10-7-6-9(11(14)12(10)15)8-4-2-1-3-5-8/h1-7,14-15H.
What are the key properties of 3-chloro-6-phenylbenzene-1,2-diol?
3-chloro-6-phenylbenzene-1,2-diol has a molecular weight of 220.66 g/mol, XLogP of 3.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-phenylbenzene-1,2-diol is sourced from PubChem (CID 11020432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).