About 5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate
5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate (PubChem CID 110204615) has the molecular formula C4H6BrN3O3
and a molecular weight of 224.01 g/mol. Its IUPAC name is 5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate.
Molecular Properties
| Compound Name | 5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate |
| PubChem CID | 110204615 |
| Molecular Formula | C4H6BrN3O3 |
| Molecular Weight | 224.01 g/mol |
| Exact Mass | 222.96 |
| IUPAC Name | 5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate |
| SMILES | Cn1nc(C(=O)O)nc1Br.O |
| InChI | InChI=1S/C4H4BrN3O2.H2O/c1-8-4(5)6-2(7-8)3(9)10;/h1H3,(H,9,10);1H2 |
| InChIKey | VWWAERNQYXWHPT-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.01 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate?
The IUPAC name of 5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate (CID 110204615) is 5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate.
What is the SMILES notation for 5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate?
The canonical SMILES for 5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate is Cn1nc(C(=O)O)nc1Br.O.
What is the InChIKey of 5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate?
The InChIKey is VWWAERNQYXWHPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BrN3O2.H2O/c1-8-4(5)6-2(7-8)3(9)10;/h1H3,(H,9,10);1H2.
What are the key properties of 5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate?
5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate has a molecular weight of 224.01 g/mol, XLogP of -0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-methyl-1,2,4-triazole-3-carboxylic acid;hydrate is sourced from PubChem (CID 110204615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).