C26H24N4O2 — CID 110205630
N-[(S)-1H-benzimidazol-2-yl(phenyl)methyl]-1-(2-methoxyethyl)indole-2-carboxamide (PubChem CID 110205630) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[(S)-1H-benzimidazol-2-yl(phenyl)methyl]-1-(2-methoxyethyl)indole-2-carboxamide.
| Compound Name | N-[(S)-1H-benzimidazol-2-yl(phenyl)methyl]-1-(2-methoxyethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 110205630 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-[(S)-1H-benzimidazol-2-yl(phenyl)methyl]-1-(2-methoxyethyl)indole-2-carboxamide |
| SMILES | COCCn1c(C(=O)N[C@@H](c2ccccc2)c2nc3ccccc3[nH]2)cc2ccccc21 |
| InChI | InChI=1S/C26H24N4O2/c1-32-16-15-30-22-14-8-5-11-19(22)17-23(30)26(31)29-24(18-9-3-2-4-10-18)25-27-20-12-6-7-13-21(20)28-25/h2-14,17,24H,15-16H2,1H3,(H,27,28)(H,29,31)/t24-/m0/s1 |
| InChIKey | SOIWDXMTWJTPQW-DEOSSOPVSA-N |
| XLogP | 4.68 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |