About azacyclotetradecane-2,14-dione
azacyclotetradecane-2,14-dione (PubChem CID 11020567) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is azacyclotetradecane-2,14-dione.
Molecular Properties
| Compound Name | azacyclotetradecane-2,14-dione |
| PubChem CID | 11020567 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | azacyclotetradecane-2,14-dione |
| SMILES | O=C1CCCCCCCCCCCC(=O)N1 |
| InChI | InChI=1S/C13H23NO2/c15-12-10-8-6-4-2-1-3-5-7-9-11-13(16)14-12/h1-11H2,(H,14,15,16) |
| InChIKey | JSJRMCCZNNFHDU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze azacyclotetradecane-2,14-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azacyclotetradecane-2,14-dione?
The IUPAC name of azacyclotetradecane-2,14-dione (CID 11020567) is azacyclotetradecane-2,14-dione.
What is the SMILES notation for azacyclotetradecane-2,14-dione?
The canonical SMILES for azacyclotetradecane-2,14-dione is O=C1CCCCCCCCCCCC(=O)N1.
What is the InChIKey of azacyclotetradecane-2,14-dione?
The InChIKey is JSJRMCCZNNFHDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c15-12-10-8-6-4-2-1-3-5-7-9-11-13(16)14-12/h1-11H2,(H,14,15,16).
What are the key properties of azacyclotetradecane-2,14-dione?
azacyclotetradecane-2,14-dione has a molecular weight of 225.33 g/mol, XLogP of 2.93, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azacyclotetradecane-2,14-dione is sourced from PubChem (CID 11020567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).