C28H25N3O8S — CID 110206025
2-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide (PubChem CID 110206025) has the molecular formula C28H25N3O8S and a molecular weight of 563.59 g/mol. Its IUPAC name is 2-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 110206025 |
| Molecular Formula | C28H25N3O8S |
| Molecular Weight | 563.59 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 2-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide |
| SMILES | COc1ccc2nc(NC(=O)CN/C(C)=C3\C(=O)C=C4Oc5c(C(C)=O)c(O)c(C)c(O)c5[C@@]4(C)C3=O)sc2c1 |
| InChI | InChI=1S/C28H25N3O8S/c1-11-23(35)21(13(3)32)25-22(24(11)36)28(4)18(39-25)9-16(33)20(26(28)37)12(2)29-10-19(34)31-27-30-15-7-6-14(38-5)8-17(15)40-27/h6-9,29,35-36H,10H2,1-5H3,(H,30,31,34)/b20-12+/t28-/m0/s1 |
| InChIKey | VJRRBJFGQZYRSC-XGOYUMGASA-N |
| XLogP | 3.42 |
| TPSA | 164.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|