C16H17N5O4 — CID 110206479
3-[(3R)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]propanamide (PubChem CID 110206479) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 3-[(3R)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]propanamide.
| Compound Name | 3-[(3R)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]propanamide |
|---|---|
| PubChem CID | 110206479 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 3-[(3R)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]propanamide |
| SMILES | Cc1noc(CNC(=O)CC[C@H]2NC(=O)c3ccccc3NC2=O)n1 |
| InChI | InChI=1S/C16H17N5O4/c1-9-18-14(25-21-9)8-17-13(22)7-6-12-16(24)19-11-5-3-2-4-10(11)15(23)20-12/h2-5,12H,6-8H2,1H3,(H,17,22)(H,19,24)(H,20,23)/t12-/m1/s1 |
| InChIKey | UYSSFUKWIRJRNX-GFCCVEGCSA-N |
| XLogP | 0.53 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |