C26H20O6 — CID 110206581
4-(4-hydroxy-3-methoxyphenyl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione (PubChem CID 110206581) has the molecular formula C26H20O6 and a molecular weight of 428.44 g/mol. Its IUPAC name is 4-(4-hydroxy-3-methoxyphenyl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione.
| Compound Name | 4-(4-hydroxy-3-methoxyphenyl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione |
|---|---|
| PubChem CID | 110206581 |
| Molecular Formula | C26H20O6 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 4-(4-hydroxy-3-methoxyphenyl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione |
| SMILES | COc1cc(C2CC(=O)Oc3c2c(C)cc2oc(=O)cc(-c4ccccc4)c32)ccc1O |
| InChI | InChI=1S/C26H20O6/c1-14-10-21-25(17(12-22(28)31-21)15-6-4-3-5-7-15)26-24(14)18(13-23(29)32-26)16-8-9-19(27)20(11-16)30-2/h3-12,18,27H,13H2,1-2H3 |
| InChIKey | JVOQXGBNVYPGTM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|