C20H15N3O4 — CID 110206625
10-(3,4-dihydroxyphenyl)-6,14-dimethyl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one (PubChem CID 110206625) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 10-(3,4-dihydroxyphenyl)-6,14-dimethyl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one.
| Compound Name | 10-(3,4-dihydroxyphenyl)-6,14-dimethyl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one |
|---|---|
| PubChem CID | 110206625 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 10-(3,4-dihydroxyphenyl)-6,14-dimethyl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one |
| SMILES | Cc1c(=O)ccc2c1oc1c(-c3ccc(O)c(O)c3)c3c[nH]n(C)c3nc12 |
| InChI | InChI=1S/C20H15N3O4/c1-9-13(24)6-4-11-17-19(27-18(9)11)16(10-3-5-14(25)15(26)7-10)12-8-21-23(2)20(12)22-17/h3-8,21,25-26H,1-2H3 |
| InChIKey | UBCBRRGIEWAJCQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|