About ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate
ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate (PubChem CID 11020666) has the molecular formula C13H11NO3
and a molecular weight of 229.23 g/mol. Its IUPAC name is ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate |
| PubChem CID | 11020666 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2oc3ccccc3c2[nH]1 |
| InChI | InChI=1S/C13H11NO3/c1-2-16-13(15)9-7-11-12(14-9)8-5-3-4-6-10(8)17-11/h3-7,14H,2H2,1H3 |
| InChIKey | YWWQJOHGNNWROG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate?
The IUPAC name of ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate (CID 11020666) is ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate.
What is the SMILES notation for ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate?
The canonical SMILES for ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate is CCOC(=O)c1cc2oc3ccccc3c2[nH]1.
What is the InChIKey of ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate?
The InChIKey is YWWQJOHGNNWROG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3/c1-2-16-13(15)9-7-11-12(14-9)8-5-3-4-6-10(8)17-11/h3-7,14H,2H2,1H3.
What are the key properties of ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate?
ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate has a molecular weight of 229.23 g/mol, XLogP of 3.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate is sourced from PubChem (CID 11020666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).