About Ruthenocene
Ruthenocene (PubChem CID 11020720) has the molecular formula C10H10Ru
and a molecular weight of 231.26 g/mol.
Molecular Properties
| Compound Name | Ruthenocene |
| PubChem CID | 11020720 |
| Molecular Formula | C10H10Ru |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | — |
| SMILES | [CH]1C=CC=C1.[CH]1C=CC=C1.[Ru] |
| InChI | InChI=1S/2C5H5.Ru/c2*1-2-4-5-3-1;/h2*1-5H; |
| InChIKey | BKEJVRMLCVMJLG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Ruthenocene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ruthenocene?
The IUPAC name of Ruthenocene (CID 11020720) is not available.
What is the SMILES notation for Ruthenocene?
The canonical SMILES for Ruthenocene is [CH]1C=CC=C1.[CH]1C=CC=C1.[Ru].
What is the InChIKey of Ruthenocene?
The InChIKey is BKEJVRMLCVMJLG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5.Ru/c2*1-2-4-5-3-1;/h2*1-5H;.
What are the key properties of Ruthenocene?
Ruthenocene has a molecular weight of 231.26 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Ruthenocene is sourced from PubChem (CID 11020720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).