C19H31N3OS — CID 110207289
(2R)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-methylsulfanyl-2-pyrrol-1-ylbutanamide (PubChem CID 110207289) has the molecular formula C19H31N3OS and a molecular weight of 349.54 g/mol. Its IUPAC name is (2R)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-methylsulfanyl-2-pyrrol-1-ylbutanamide.
| Compound Name | (2R)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-methylsulfanyl-2-pyrrol-1-ylbutanamide |
|---|---|
| PubChem CID | 110207289 |
| Molecular Formula | C19H31N3OS |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | (2R)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-methylsulfanyl-2-pyrrol-1-ylbutanamide |
| SMILES | CSCC[C@H](C(=O)NC[C@@H]1CCCN2CCCC[C@H]12)n1cccc1 |
| InChI | InChI=1S/C19H31N3OS/c1-24-14-9-18(22-11-4-5-12-22)19(23)20-15-16-7-6-13-21-10-3-2-8-17(16)21/h4-5,11-12,16-18H,2-3,6-10,13-15H2,1H3,(H,20,23)/t16-,17+,18+/m0/s1 |
| InChIKey | ITDNLKJUIHRNCA-RCCFBDPRSA-N |
| XLogP | 3.16 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |