C27H38N2O4 — CID 110207606
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-(4-butyl-8-methyl-2-oxochromen-7-yl)oxy-N-methylacetamide (PubChem CID 110207606) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-(4-butyl-8-methyl-2-oxochromen-7-yl)oxy-N-methylacetamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-(4-butyl-8-methyl-2-oxochromen-7-yl)oxy-N-methylacetamide |
|---|---|
| PubChem CID | 110207606 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-(4-butyl-8-methyl-2-oxochromen-7-yl)oxy-N-methylacetamide |
| SMILES | CCCCc1cc(=O)oc2c(C)c(OCC(=O)N(C)C[C@@H]3CCCN4CCCC[C@H]34)ccc12 |
| InChI | InChI=1S/C27H38N2O4/c1-4-5-9-20-16-26(31)33-27-19(2)24(13-12-22(20)27)32-18-25(30)28(3)17-21-10-8-15-29-14-7-6-11-23(21)29/h12-13,16,21,23H,4-11,14-15,17-18H2,1-3H3/t21-,23+/m0/s1 |
| InChIKey | NUOPMSZIIQEWDO-JTHBVZDNSA-N |
| XLogP | 4.55 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|