C31H38N4O3 — CID 110207634
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-6-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)hexanamide (PubChem CID 110207634) has the molecular formula C31H38N4O3 and a molecular weight of 514.67 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-6-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)hexanamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-6-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)hexanamide |
|---|---|
| PubChem CID | 110207634 |
| Molecular Formula | C31H38N4O3 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-6-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2N2C(=O)c3ccccc3C12)NC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C31H38N4O3/c36-28(32-21-22-11-10-19-33-18-9-7-15-26(22)33)17-2-1-8-20-34-29-23-12-3-4-13-24(23)31(38)35(29)27-16-6-5-14-25(27)30(34)37/h3-6,12-14,16,22,26,29H,1-2,7-11,15,17-21H2,(H,32,36)/t22-,26+,29?/m0/s1 |
| InChIKey | LZCHDIAUDKCJSX-KLDUMMKMSA-N |
| XLogP | 4.74 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|