C23H14ClNO5 — CID 110207908
3-(4-chlorophenyl)-5-hydroxy-10-pyridin-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 110207908) has the molecular formula C23H14ClNO5 and a molecular weight of 419.82 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-hydroxy-10-pyridin-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 3-(4-chlorophenyl)-5-hydroxy-10-pyridin-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 110207908 |
| Molecular Formula | C23H14ClNO5 |
| Molecular Weight | 419.82 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 3-(4-chlorophenyl)-5-hydroxy-10-pyridin-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1CC(c2cccnc2)c2c(cc(O)c3c(=O)c(-c4ccc(Cl)cc4)coc23)O1 |
| InChI | InChI=1S/C23H14ClNO5/c24-14-5-3-12(4-6-14)16-11-29-23-20-15(13-2-1-7-25-10-13)8-19(27)30-18(20)9-17(26)21(23)22(16)28/h1-7,9-11,15,26H,8H2 |
| InChIKey | VVWFFNXZRDYJPX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.82 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|