About diethyloxidanium;ethoxyethane;tetrafluoroborate
diethyloxidanium;ethoxyethane;tetrafluoroborate (PubChem CID 11020861) has the molecular formula C8H21BF4O2
and a molecular weight of 236.06 g/mol. Its IUPAC name is diethyloxidanium;ethoxyethane;tetrafluoroborate.
Molecular Properties
| Compound Name | diethyloxidanium;ethoxyethane;tetrafluoroborate |
| PubChem CID | 11020861 |
| Molecular Formula | C8H21BF4O2 |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | diethyloxidanium;ethoxyethane;tetrafluoroborate |
| SMILES | CCOCC.CC[OH+]CC.F[B-](F)(F)F |
| InChI | InChI=1S/2C4H10O.BF4/c2*1-3-5-4-2;2-1(3,4)5/h2*3-4H2,1-2H3;/q;;-1/p+1 |
| InChIKey | UORUNVPBWPIKHQ-UHFFFAOYSA-O |
| XLogP | 2.90 |
| TPSA | 22.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethyloxidanium;ethoxyethane;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyloxidanium;ethoxyethane;tetrafluoroborate?
The IUPAC name of diethyloxidanium;ethoxyethane;tetrafluoroborate (CID 11020861) is diethyloxidanium;ethoxyethane;tetrafluoroborate.
What is the SMILES notation for diethyloxidanium;ethoxyethane;tetrafluoroborate?
The canonical SMILES for diethyloxidanium;ethoxyethane;tetrafluoroborate is CCOCC.CC[OH+]CC.F[B-](F)(F)F.
What is the InChIKey of diethyloxidanium;ethoxyethane;tetrafluoroborate?
The InChIKey is UORUNVPBWPIKHQ-UHFFFAOYSA-O. The full InChI is InChI=1S/2C4H10O.BF4/c2*1-3-5-4-2;2-1(3,4)5/h2*3-4H2,1-2H3;/q;;-1/p+1.
What are the key properties of diethyloxidanium;ethoxyethane;tetrafluoroborate?
diethyloxidanium;ethoxyethane;tetrafluoroborate has a molecular weight of 236.06 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diethyloxidanium;ethoxyethane;tetrafluoroborate is sourced from PubChem (CID 11020861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).