C11H14N2O2S — CID 11020957
(5E)-1,2-dimethyl-5-[(5-nitrothiophen-2-yl)methylidene]pyrrolidine (PubChem CID 11020957) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is (5E)-1,2-dimethyl-5-[(5-nitrothiophen-2-yl)methylidene]pyrrolidine.
| Compound Name | (5E)-1,2-dimethyl-5-[(5-nitrothiophen-2-yl)methylidene]pyrrolidine |
|---|---|
| PubChem CID | 11020957 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (5E)-1,2-dimethyl-5-[(5-nitrothiophen-2-yl)methylidene]pyrrolidine |
| SMILES | CC1CC/C(=C\c2ccc([N+](=O)[O-])s2)N1C |
| InChI | InChI=1S/C11H14N2O2S/c1-8-3-4-9(12(8)2)7-10-5-6-11(16-10)13(14)15/h5-8H,3-4H2,1-2H3/b9-7+ |
| InChIKey | OJFHRKXAOLBTLQ-VQHVLOKHSA-N |
| XLogP | 3.11 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|