C15H26O2 — CID 11020974
(4S,5S)-4-heptyl-2,2-dimethyl-5-prop-2-ynyl-1,3-dioxolane (PubChem CID 11020974) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (4S,5S)-4-heptyl-2,2-dimethyl-5-prop-2-ynyl-1,3-dioxolane.
| Compound Name | (4S,5S)-4-heptyl-2,2-dimethyl-5-prop-2-ynyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11020974 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (4S,5S)-4-heptyl-2,2-dimethyl-5-prop-2-ynyl-1,3-dioxolane |
| SMILES | C#CC[C@@H]1OC(C)(C)O[C@H]1CCCCCCC |
| InChI | InChI=1S/C15H26O2/c1-5-7-8-9-10-12-14-13(11-6-2)16-15(3,4)17-14/h2,13-14H,5,7-12H2,1,3-4H3/t13-,14-/m0/s1 |
| InChIKey | UUCPBMMYJZTIBO-KBPBESRZSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|