C20H31N5O2 — CID 110210321
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-1-(6-oxo-1H-pyridazin-3-yl)piperidine-4-carboxamide (PubChem CID 110210321) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-1-(6-oxo-1H-pyridazin-3-yl)piperidine-4-carboxamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-1-(6-oxo-1H-pyridazin-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110210321 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-1-(6-oxo-1H-pyridazin-3-yl)piperidine-4-carboxamide |
| SMILES | O=C(NCC1CCCN2CCCCC12)C1CCN(c2ccc(=O)[nH]n2)CC1 |
| InChI | InChI=1S/C20H31N5O2/c26-19-7-6-18(22-23-19)25-12-8-15(9-13-25)20(27)21-14-16-4-3-11-24-10-2-1-5-17(16)24/h6-7,15-17H,1-5,8-14H2,(H,21,27)(H,23,26) |
| InChIKey | ULHDWCGRINKQLP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |