C14H28OSi — CID 11021034
(2E,4S)-4,8-dimethyl-1-trimethylsilylnona-2,7-dien-4-ol (PubChem CID 11021034) has the molecular formula C14H28OSi and a molecular weight of 240.46 g/mol. Its IUPAC name is (2E,4S)-4,8-dimethyl-1-trimethylsilylnona-2,7-dien-4-ol.
| Compound Name | (2E,4S)-4,8-dimethyl-1-trimethylsilylnona-2,7-dien-4-ol |
|---|---|
| PubChem CID | 11021034 |
| Molecular Formula | C14H28OSi |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (2E,4S)-4,8-dimethyl-1-trimethylsilylnona-2,7-dien-4-ol |
| SMILES | CC(C)=CCC[C@](C)(O)/C=C/C[Si](C)(C)C |
| InChI | InChI=1S/C14H28OSi/c1-13(2)9-7-10-14(3,15)11-8-12-16(4,5)6/h8-9,11,15H,7,10,12H2,1-6H3/b11-8+/t14-/m0/s1 |
| InChIKey | SXRRBXWTKSLHIL-ZHZWZMEUSA-N |
| XLogP | 4.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|