About (3S)-1,1-dibromo-3-methylpent-1-ene
(3S)-1,1-dibromo-3-methylpent-1-ene (PubChem CID 11021058) has the molecular formula C6H10Br2
and a molecular weight of 241.95 g/mol. Its IUPAC name is (3S)-1,1-dibromo-3-methylpent-1-ene.
Molecular Properties
| Compound Name | (3S)-1,1-dibromo-3-methylpent-1-ene |
| PubChem CID | 11021058 |
| Molecular Formula | C6H10Br2 |
| Molecular Weight | 241.95 g/mol |
| Exact Mass | 239.91 |
| IUPAC Name | (3S)-1,1-dibromo-3-methylpent-1-ene |
| SMILES | CC[C@H](C)C=C(Br)Br |
| InChI | InChI=1S/C6H10Br2/c1-3-5(2)4-6(7)8/h4-5H,3H2,1-2H3/t5-/m0/s1 |
| InChIKey | PPVHYRCRKWRZIP-YFKPBYRVSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.95 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (3S)-1,1-dibromo-3-methylpent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,1-dibromo-3-methylpent-1-ene?
The IUPAC name of (3S)-1,1-dibromo-3-methylpent-1-ene (CID 11021058) is (3S)-1,1-dibromo-3-methylpent-1-ene.
What is the SMILES notation for (3S)-1,1-dibromo-3-methylpent-1-ene?
The canonical SMILES for (3S)-1,1-dibromo-3-methylpent-1-ene is CC[C@H](C)C=C(Br)Br.
What is the InChIKey of (3S)-1,1-dibromo-3-methylpent-1-ene?
The InChIKey is PPVHYRCRKWRZIP-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H10Br2/c1-3-5(2)4-6(7)8/h4-5H,3H2,1-2H3/t5-/m0/s1.
What are the key properties of (3S)-1,1-dibromo-3-methylpent-1-ene?
(3S)-1,1-dibromo-3-methylpent-1-ene has a molecular weight of 241.95 g/mol, XLogP of 3.66, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,1-dibromo-3-methylpent-1-ene is sourced from PubChem (CID 11021058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).