C18H14F6N6O — CID 110211075
4-(3-methoxyphenyl)-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 110211075) has the molecular formula C18H14F6N6O and a molecular weight of 444.34 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(3-methoxyphenyl)-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 110211075 |
| Molecular Formula | C18H14F6N6O |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 4-(3-methoxyphenyl)-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | COc1cccc(-c2cc(C(F)(F)F)nc(N/N=C/c3ccn(CC(F)(F)F)n3)n2)c1 |
| InChI | InChI=1S/C18H14F6N6O/c1-31-13-4-2-3-11(7-13)14-8-15(18(22,23)24)27-16(26-14)28-25-9-12-5-6-30(29-12)10-17(19,20)21/h2-9H,10H2,1H3,(H,26,27,28)/b25-9+ |
| InChIKey | MDYVUGGOTOSCQL-YCPBAFNGSA-N |
| XLogP | 4.38 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|