C19H26N2O2 — CID 110211195
(3S)-2-[(3-methoxy-4-prop-2-ynoxyphenyl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 110211195) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is (3S)-2-[(3-methoxy-4-prop-2-ynoxyphenyl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (3S)-2-[(3-methoxy-4-prop-2-ynoxyphenyl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 110211195 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (3S)-2-[(3-methoxy-4-prop-2-ynoxyphenyl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | C#CCOc1ccc(CN2CC3CCCN3C[C@@H]2C)cc1OC |
| InChI | InChI=1S/C19H26N2O2/c1-4-10-23-18-8-7-16(11-19(18)22-3)13-21-14-17-6-5-9-20(17)12-15(21)2/h1,7-8,11,15,17H,5-6,9-10,12-14H2,2-3H3/t15-,17?/m0/s1 |
| InChIKey | HVVRVTPSJPCGEC-MYJWUSKBSA-N |
| XLogP | 2.38 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|