About [(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene
[(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene (PubChem CID 11021122) has the molecular formula C13H15F3O
and a molecular weight of 244.26 g/mol. Its IUPAC name is [(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene.
Molecular Properties
| Compound Name | [(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene |
| PubChem CID | 11021122 |
| Molecular Formula | C13H15F3O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | [(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene |
| SMILES | CCO/C(=C\CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H15F3O/c1-2-17-12(13(14,15)16)10-6-9-11-7-4-3-5-8-11/h3-5,7-8,10H,2,6,9H2,1H3/b12-10- |
| InChIKey | NXYAHAFYBOJIDB-BENRWUELSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene?
The IUPAC name of [(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene (CID 11021122) is [(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene.
What is the SMILES notation for [(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene?
The canonical SMILES for [(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene is CCO/C(=C\CCc1ccccc1)C(F)(F)F.
What is the InChIKey of [(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene?
The InChIKey is NXYAHAFYBOJIDB-BENRWUELSA-N. The full InChI is InChI=1S/C13H15F3O/c1-2-17-12(13(14,15)16)10-6-9-11-7-4-3-5-8-11/h3-5,7-8,10H,2,6,9H2,1H3/b12-10-.
What are the key properties of [(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene?
[(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene has a molecular weight of 244.26 g/mol, XLogP of 4.10, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene is sourced from PubChem (CID 11021122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).